C21H32N6O — CID 111290349
N-ethyl-4-(3-methoxyphenyl)-N'-(2-methyl-3-pyrazol-1-ylpropyl)piperazine-1-carboximidamide (PubChem CID 111290349) has the molecular formula C21H32N6O and a molecular weight of 384.53 g/mol. Its IUPAC name is N-ethyl-4-(3-methoxyphenyl)-N'-(2-methyl-3-pyrazol-1-ylpropyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(3-methoxyphenyl)-N'-(2-methyl-3-pyrazol-1-ylpropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111290349 |
| Molecular Formula | C21H32N6O |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | N-ethyl-4-(3-methoxyphenyl)-N'-(2-methyl-3-pyrazol-1-ylpropyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)Cn1cccn1)N1CCN(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C21H32N6O/c1-4-22-21(23-16-18(2)17-27-10-6-9-24-27)26-13-11-25(12-14-26)19-7-5-8-20(15-19)28-3/h5-10,15,18H,4,11-14,16-17H2,1-3H3,(H,22,23) |
| InChIKey | ZNOMFYKKJKNCFV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|