C23H40N6O — CID 111243175
N-ethyl-4-(4-methoxyphenyl)-N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111243175) has the molecular formula C23H40N6O and a molecular weight of 416.61 g/mol. Its IUPAC name is N-ethyl-4-(4-methoxyphenyl)-N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(4-methoxyphenyl)-N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111243175 |
| Molecular Formula | C23H40N6O |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | N-ethyl-4-(4-methoxyphenyl)-N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)CN1CCN(C)CC1)N1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C23H40N6O/c1-5-24-23(25-18-20(2)19-27-12-10-26(3)11-13-27)29-16-14-28(15-17-29)21-6-8-22(30-4)9-7-21/h6-9,20H,5,10-19H2,1-4H3,(H,24,25) |
| InChIKey | FZIJOJJMGNSPEV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|