C20H28ClIN4O2S — CID 111502282
N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethyl-4-(3-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111502282) has the molecular formula C20H28ClIN4O2S and a molecular weight of 550.89 g/mol. Its IUPAC name is N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethyl-4-(3-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethyl-4-(3-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111502282 |
| Molecular Formula | C20H28ClIN4O2S |
| Molecular Weight | 550.89 g/mol |
| Exact Mass | 550.07 |
| IUPAC Name | N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethyl-4-(3-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)N1CCN(c2cccc(OC)c2)CC1.I |
| InChI | InChI=1S/C20H27ClN4O2S.HI/c1-3-22-20(23-14-17(26)18-7-8-19(21)28-18)25-11-9-24(10-12-25)15-5-4-6-16(13-15)27-2;/h4-8,13,17,26H,3,9-12,14H2,1-2H3,(H,22,23);1H |
| InChIKey | GEOWCYCFOMZLDQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.89 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|