C25H33IN6O — CID 111290180
N-ethyl-N'-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-4-(3-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111290180) has the molecular formula C25H33IN6O and a molecular weight of 560.48 g/mol. Its IUPAC name is N-ethyl-N'-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-4-(3-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-4-(3-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111290180 |
| Molecular Formula | C25H33IN6O |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | N-ethyl-N'-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-4-(3-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(Cn2ccnc2)c1)N1CCN(c2cccc(OC)c2)CC1.I |
| InChI | InChI=1S/C25H32N6O.HI/c1-3-27-25(28-18-21-6-4-7-22(16-21)19-29-11-10-26-20-29)31-14-12-30(13-15-31)23-8-5-9-24(17-23)32-2;/h4-11,16-17,20H,3,12-15,18-19H2,1-2H3,(H,27,28);1H |
| InChIKey | SIFYYOFBIYBJQM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|