C20H26N4O2 — CID 111254367
methyl 1-[N-ethyl-N'-(quinolin-8-ylmethyl)carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111254367) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is methyl 1-[N-ethyl-N'-(quinolin-8-ylmethyl)carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-ethyl-N'-(quinolin-8-ylmethyl)carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111254367 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | methyl 1-[N-ethyl-N'-(quinolin-8-ylmethyl)carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\Cc1cccc2cccnc12)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C20H26N4O2/c1-3-21-20(24-12-9-16(10-13-24)19(25)26-2)23-14-17-7-4-6-15-8-5-11-22-18(15)17/h4-8,11,16H,3,9-10,12-14H2,1-2H3,(H,21,23) |
| InChIKey | LLKJCPZPRXUCOQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|