C19H24N4O2 — CID 166186194
4-N-ethyl-1-N-(quinolin-8-ylmethyl)piperidine-1,4-dicarboxamide (PubChem CID 166186194) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 4-N-ethyl-1-N-(quinolin-8-ylmethyl)piperidine-1,4-dicarboxamide.
| Compound Name | 4-N-ethyl-1-N-(quinolin-8-ylmethyl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 166186194 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 4-N-ethyl-1-N-(quinolin-8-ylmethyl)piperidine-1,4-dicarboxamide |
| SMILES | CCNC(=O)C1CCN(C(=O)NCc2cccc3cccnc23)CC1 |
| InChI | InChI=1S/C19H24N4O2/c1-2-20-18(24)15-8-11-23(12-9-15)19(25)22-13-16-6-3-5-14-7-4-10-21-17(14)16/h3-7,10,15H,2,8-9,11-13H2,1H3,(H,20,24)(H,22,25) |
| InChIKey | XOUQAGRWYZNZRH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |