C18H23N3O2 — CID 97096798
(2S,6R)-2-ethyl-6-methyl-N-(quinolin-8-ylmethyl)morpholine-4-carboxamide (PubChem CID 97096798) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is (2S,6R)-2-ethyl-6-methyl-N-(quinolin-8-ylmethyl)morpholine-4-carboxamide.
| Compound Name | (2S,6R)-2-ethyl-6-methyl-N-(quinolin-8-ylmethyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 97096798 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (2S,6R)-2-ethyl-6-methyl-N-(quinolin-8-ylmethyl)morpholine-4-carboxamide |
| SMILES | CC[C@H]1CN(C(=O)NCc2cccc3cccnc23)C[C@@H](C)O1 |
| InChI | InChI=1S/C18H23N3O2/c1-3-16-12-21(11-13(2)23-16)18(22)20-10-15-7-4-6-14-8-5-9-19-17(14)15/h4-9,13,16H,3,10-12H2,1-2H3,(H,20,22)/t13-,16+/m1/s1 |
| InChIKey | GYTANMXIKCBXFD-CJNGLKHVSA-N |
| XLogP | 2.94 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |