About (2R,5R)-2,5-dimethyl-4-(quinolin-8-ylmethyl)morpholine
(2R,5R)-2,5-dimethyl-4-(quinolin-8-ylmethyl)morpholine (PubChem CID 94062962) has the molecular formula C16H20N2O
and a molecular weight of 256.35 g/mol. Its IUPAC name is (2R,5R)-2,5-dimethyl-4-(quinolin-8-ylmethyl)morpholine.
Molecular Properties
| Compound Name | (2R,5R)-2,5-dimethyl-4-(quinolin-8-ylmethyl)morpholine |
| PubChem CID | 94062962 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (2R,5R)-2,5-dimethyl-4-(quinolin-8-ylmethyl)morpholine |
| SMILES | C[C@@H]1CN(Cc2cccc3cccnc23)[C@H](C)CO1 |
| InChI | InChI=1S/C16H20N2O/c1-12-11-19-13(2)9-18(12)10-15-6-3-5-14-7-4-8-17-16(14)15/h3-8,12-13H,9-11H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | KJJQPHAQWNARPC-CHWSQXEVSA-N |
| XLogP | 2.84 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,5R)-2,5-dimethyl-4-(quinolin-8-ylmethyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-2,5-dimethyl-4-(quinolin-8-ylmethyl)morpholine?
The IUPAC name of (2R,5R)-2,5-dimethyl-4-(quinolin-8-ylmethyl)morpholine (CID 94062962) is (2R,5R)-2,5-dimethyl-4-(quinolin-8-ylmethyl)morpholine.
What is the SMILES notation for (2R,5R)-2,5-dimethyl-4-(quinolin-8-ylmethyl)morpholine?
The canonical SMILES for (2R,5R)-2,5-dimethyl-4-(quinolin-8-ylmethyl)morpholine is C[C@@H]1CN(Cc2cccc3cccnc23)[C@H](C)CO1.
What is the InChIKey of (2R,5R)-2,5-dimethyl-4-(quinolin-8-ylmethyl)morpholine?
The InChIKey is KJJQPHAQWNARPC-CHWSQXEVSA-N. The full InChI is InChI=1S/C16H20N2O/c1-12-11-19-13(2)9-18(12)10-15-6-3-5-14-7-4-8-17-16(14)15/h3-8,12-13H,9-11H2,1-2H3/t12-,13-/m1/s1.
What are the key properties of (2R,5R)-2,5-dimethyl-4-(quinolin-8-ylmethyl)morpholine?
(2R,5R)-2,5-dimethyl-4-(quinolin-8-ylmethyl)morpholine has a molecular weight of 256.35 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-2,5-dimethyl-4-(quinolin-8-ylmethyl)morpholine is sourced from PubChem (CID 94062962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).