C17H23N3 — CID 64845277
8-[(2-ethyl-5-methylpiperazin-1-yl)methyl]quinoline (PubChem CID 64845277) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 8-[(2-ethyl-5-methylpiperazin-1-yl)methyl]quinoline.
| Compound Name | 8-[(2-ethyl-5-methylpiperazin-1-yl)methyl]quinoline |
|---|---|
| PubChem CID | 64845277 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 8-[(2-ethyl-5-methylpiperazin-1-yl)methyl]quinoline |
| SMILES | CCC1CNC(C)CN1Cc1cccc2cccnc12 |
| InChI | InChI=1S/C17H23N3/c1-3-16-10-19-13(2)11-20(16)12-15-7-4-6-14-8-5-9-18-17(14)15/h4-9,13,16,19H,3,10-12H2,1-2H3 |
| InChIKey | SIVPTSKUYUIOGE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |