C21H29N3O2 — CID 95974785
N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]butyl]-2-quinolin-8-ylacetamide (PubChem CID 95974785) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]butyl]-2-quinolin-8-ylacetamide.
| Compound Name | N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]butyl]-2-quinolin-8-ylacetamide |
|---|---|
| PubChem CID | 95974785 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]butyl]-2-quinolin-8-ylacetamide |
| SMILES | C[C@@H]1CN(CCCCNC(=O)Cc2cccc3cccnc23)C[C@H](C)O1 |
| InChI | InChI=1S/C21H29N3O2/c1-16-14-24(15-17(2)26-16)12-4-3-10-22-20(25)13-19-8-5-7-18-9-6-11-23-21(18)19/h5-9,11,16-17H,3-4,10,12-15H2,1-2H3,(H,22,25)/t16-,17+ |
| InChIKey | OCJDUXNOLXZIHB-CALCHBBNSA-N |
| XLogP | 2.78 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|