C16H21IN4O2S — CID 110914565
2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-phenylguanidine;hydroiodide (PubChem CID 110914565) has the molecular formula C16H21IN4O2S and a molecular weight of 460.34 g/mol. Its IUPAC name is 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110914565 |
| Molecular Formula | C16H21IN4O2S |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-phenylguanidine;hydroiodide |
| SMILES | CN(C)S(=O)(=O)c1ccccc1C/N=C(\N)Nc1ccccc1.I |
| InChI | InChI=1S/C16H20N4O2S.HI/c1-20(2)23(21,22)15-11-7-6-8-13(15)12-18-16(17)19-14-9-4-3-5-10-14;/h3-11H,12H2,1-2H3,(H3,17,18,19);1H |
| InChIKey | WPWGEWMQMDCXKW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|