C10H16IN5 — CID 119119982
2-[(2-methylpyrimidin-4-yl)methyl]-1-prop-2-enylguanidine;hydroiodide (PubChem CID 119119982) has the molecular formula C10H16IN5 and a molecular weight of 333.18 g/mol. Its IUPAC name is 2-[(2-methylpyrimidin-4-yl)methyl]-1-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-[(2-methylpyrimidin-4-yl)methyl]-1-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119119982 |
| Molecular Formula | C10H16IN5 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-[(2-methylpyrimidin-4-yl)methyl]-1-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(N)=N/Cc1ccnc(C)n1.I |
| InChI | InChI=1S/C10H15N5.HI/c1-3-5-13-10(11)14-7-9-4-6-12-8(2)15-9;/h3-4,6H,1,5,7H2,2H3,(H3,11,13,14);1H |
| InChIKey | MHIPVHDBWJDLMS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|