C8H13N7 — CID 83034076
1-(diaminomethylidene)-2-[(2-methylpyrimidin-4-yl)methyl]guanidine (PubChem CID 83034076) has the molecular formula C8H13N7 and a molecular weight of 207.24 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[(2-methylpyrimidin-4-yl)methyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[(2-methylpyrimidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 83034076 |
| Molecular Formula | C8H13N7 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 1-(diaminomethylidene)-2-[(2-methylpyrimidin-4-yl)methyl]guanidine |
| SMILES | Cc1nccc(C/N=C(\N)N=C(N)N)n1 |
| InChI | InChI=1S/C8H13N7/c1-5-12-3-2-6(14-5)4-13-8(11)15-7(9)10/h2-3H,4H2,1H3,(H6,9,10,11,13,15) |
| InChIKey | VKGGGRBPNBJRMO-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|