C9H15N5O — CID 77030166
N'-hydroxy-3-[(2-methylpyrimidin-4-yl)methylamino]propanimidamide (PubChem CID 77030166) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is N'-hydroxy-3-[(2-methylpyrimidin-4-yl)methylamino]propanimidamide.
| Compound Name | N'-hydroxy-3-[(2-methylpyrimidin-4-yl)methylamino]propanimidamide |
|---|---|
| PubChem CID | 77030166 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | N'-hydroxy-3-[(2-methylpyrimidin-4-yl)methylamino]propanimidamide |
| SMILES | Cc1nccc(CNCCC(N)=NO)n1 |
| InChI | InChI=1S/C9H15N5O/c1-7-12-5-2-8(13-7)6-11-4-3-9(10)14-15/h2,5,11,15H,3-4,6H2,1H3,(H2,10,14) |
| InChIKey | AKBZOFZHBCKGFT-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|