C9H14N4O2 — CID 83211810
2-[(2-methylpyrimidin-4-yl)methylamino]ethyl carbamate (PubChem CID 83211810) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-[(2-methylpyrimidin-4-yl)methylamino]ethyl carbamate.
| Compound Name | 2-[(2-methylpyrimidin-4-yl)methylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83211810 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-[(2-methylpyrimidin-4-yl)methylamino]ethyl carbamate |
| SMILES | Cc1nccc(CNCCOC(N)=O)n1 |
| InChI | InChI=1S/C9H14N4O2/c1-7-12-3-2-8(13-7)6-11-4-5-15-9(10)14/h2-3,11H,4-6H2,1H3,(H2,10,14) |
| InChIKey | AVHAQZKHLQMWAC-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|