C12H19N3O — CID 106397557
2-but-3-enoxy-N-[(2-methylpyrimidin-4-yl)methyl]ethanamine (PubChem CID 106397557) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-but-3-enoxy-N-[(2-methylpyrimidin-4-yl)methyl]ethanamine.
| Compound Name | 2-but-3-enoxy-N-[(2-methylpyrimidin-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106397557 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 2-but-3-enoxy-N-[(2-methylpyrimidin-4-yl)methyl]ethanamine |
| SMILES | C=CCCOCCNCc1ccnc(C)n1 |
| InChI | InChI=1S/C12H19N3O/c1-3-4-8-16-9-7-13-10-12-5-6-14-11(2)15-12/h3,5-6,13H,1,4,7-10H2,2H3 |
| InChIKey | BICUVECTYUROIN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|