C7H12N6S — CID 83036330
1-(diaminomethylidene)-2-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 83036330) has the molecular formula C7H12N6S and a molecular weight of 212.28 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 83036330 |
| Molecular Formula | C7H12N6S |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 1-(diaminomethylidene)-2-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | Cc1nc(C/N=C(\N)N=C(N)N)cs1 |
| InChI | InChI=1S/C7H12N6S/c1-4-12-5(3-14-4)2-11-7(10)13-6(8)9/h3H,2H2,1H3,(H6,8,9,10,11,13) |
| InChIKey | DCQCUFAGRLISBK-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|