C12H13N3S — CID 63177005
N'-[(2-methyl-1,3-thiazol-4-yl)methyl]benzenecarboximidamide (PubChem CID 63177005) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is N'-[(2-methyl-1,3-thiazol-4-yl)methyl]benzenecarboximidamide.
| Compound Name | N'-[(2-methyl-1,3-thiazol-4-yl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 63177005 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | N'-[(2-methyl-1,3-thiazol-4-yl)methyl]benzenecarboximidamide |
| SMILES | Cc1nc(C/N=C(\N)c2ccccc2)cs1 |
| InChI | InChI=1S/C12H13N3S/c1-9-15-11(8-16-9)7-14-12(13)10-5-3-2-4-6-10/h2-6,8H,7H2,1H3,(H2,13,14) |
| InChIKey | WIQDMRFUGZQLOC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|