C15H16N2O2S — CID 47290668
N-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-oxo-4-phenylbutanamide (PubChem CID 47290668) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-oxo-4-phenylbutanamide.
| Compound Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 47290668 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-oxo-4-phenylbutanamide |
| SMILES | Cc1nc(CNC(=O)CCC(=O)c2ccccc2)cs1 |
| InChI | InChI=1S/C15H16N2O2S/c1-11-17-13(10-20-11)9-16-15(19)8-7-14(18)12-5-3-2-4-6-12/h2-6,10H,7-9H2,1H3,(H,16,19) |
| InChIKey | YKTXUHBNXSLIMC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |