C20H20N2OS — CID 110717408
N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3-diphenylpropanamide (PubChem CID 110717408) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3-diphenylpropanamide.
| Compound Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 110717408 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3-diphenylpropanamide |
| SMILES | Cc1nc(CNC(=O)CC(c2ccccc2)c2ccccc2)cs1 |
| InChI | InChI=1S/C20H20N2OS/c1-15-22-18(14-24-15)13-21-20(23)12-19(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,14,19H,12-13H2,1H3,(H,21,23) |
| InChIKey | FHPQXEYDRLEZQA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |