C11H18IN5 — CID 119119969
1-(2-methylprop-2-enyl)-2-[(2-methylpyrimidin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 119119969) has the molecular formula C11H18IN5 and a molecular weight of 347.20 g/mol. Its IUPAC name is 1-(2-methylprop-2-enyl)-2-[(2-methylpyrimidin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-methylprop-2-enyl)-2-[(2-methylpyrimidin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119119969 |
| Molecular Formula | C11H18IN5 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 1-(2-methylprop-2-enyl)-2-[(2-methylpyrimidin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C=C(C)CN/C(N)=N/Cc1ccnc(C)n1.I |
| InChI | InChI=1S/C11H17N5.HI/c1-8(2)6-14-11(12)15-7-10-4-5-13-9(3)16-10;/h4-5H,1,6-7H2,2-3H3,(H3,12,14,15);1H |
| InChIKey | KKZZTNQKGPDSHJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|