C15H16BrFIN3 — CID 110926291
2-[2-(3-bromo-4-fluorophenyl)ethyl]-1-phenylguanidine;hydroiodide (PubChem CID 110926291) has the molecular formula C15H16BrFIN3 and a molecular weight of 464.12 g/mol. Its IUPAC name is 2-[2-(3-bromo-4-fluorophenyl)ethyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[2-(3-bromo-4-fluorophenyl)ethyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110926291 |
| Molecular Formula | C15H16BrFIN3 |
| Molecular Weight | 464.12 g/mol |
| Exact Mass | 462.96 |
| IUPAC Name | 2-[2-(3-bromo-4-fluorophenyl)ethyl]-1-phenylguanidine;hydroiodide |
| SMILES | I.N/C(=N\CCc1ccc(F)c(Br)c1)Nc1ccccc1 |
| InChI | InChI=1S/C15H15BrFN3.HI/c16-13-10-11(6-7-14(13)17)8-9-19-15(18)20-12-4-2-1-3-5-12;/h1-7,10H,8-9H2,(H3,18,19,20);1H |
| InChIKey | DQKXLTFZRVMDAU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.12 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|