C21H29FN8O — CID 111823375
2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111823375) has the molecular formula C21H29FN8O and a molecular weight of 428.52 g/mol. Its IUPAC name is 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111823375 |
| Molecular Formula | C21H29FN8O |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | N#Cc1c(CCC/N=C(\N)NCCCN2CCOCC2)nn(-c2ccc(F)cc2)c1N |
| InChI | InChI=1S/C21H29FN8O/c22-16-4-6-17(7-5-16)30-20(24)18(15-23)19(28-30)3-1-8-26-21(25)27-9-2-10-29-11-13-31-14-12-29/h4-7H,1-3,8-14,24H2,(H3,25,26,27) |
| InChIKey | LIEYOOXWPVHLQI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|