C20H28FN5 — CID 111513554
1-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-2-methyl-3-(4-methylcyclohexyl)guanidine (PubChem CID 111513554) has the molecular formula C20H28FN5 and a molecular weight of 357.48 g/mol. Its IUPAC name is 1-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-2-methyl-3-(4-methylcyclohexyl)guanidine.
| Compound Name | 1-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-2-methyl-3-(4-methylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 111513554 |
| Molecular Formula | C20H28FN5 |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 1-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-2-methyl-3-(4-methylcyclohexyl)guanidine |
| SMILES | C/N=C(\NCCc1ccn(-c2ccc(F)cc2)n1)NC1CCC(C)CC1 |
| InChI | InChI=1S/C20H28FN5/c1-15-3-7-17(8-4-15)24-20(22-2)23-13-11-18-12-14-26(25-18)19-9-5-16(21)6-10-19/h5-6,9-10,12,14-15,17H,3-4,7-8,11,13H2,1-2H3,(H2,22,23,24) |
| InChIKey | GYRXVSRGUBQGTD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|