C19H27FIN5S — CID 109484871
2-ethyl-N-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-N'-methylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109484871) has the molecular formula C19H27FIN5S and a molecular weight of 503.43 g/mol. Its IUPAC name is 2-ethyl-N-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-N'-methylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-ethyl-N-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109484871 |
| Molecular Formula | C19H27FIN5S |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | 2-ethyl-N-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC1CN(/C(=N/C)NCCc2ccn(-c3ccc(F)cc3)n2)CCS1.I |
| InChI | InChI=1S/C19H26FN5S.HI/c1-3-18-14-24(12-13-26-18)19(21-2)22-10-8-16-9-11-25(23-16)17-6-4-15(20)5-7-17;/h4-7,9,11,18H,3,8,10,12-14H2,1-2H3,(H,21,22);1H |
| InChIKey | LCMYAWWGFOJILP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|