C14H22BrN3OS — CID 109485362
N-[2-(5-bromofuran-2-yl)ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide (PubChem CID 109485362) has the molecular formula C14H22BrN3OS and a molecular weight of 360.32 g/mol. Its IUPAC name is N-[2-(5-bromofuran-2-yl)ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide.
| Compound Name | N-[2-(5-bromofuran-2-yl)ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109485362 |
| Molecular Formula | C14H22BrN3OS |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | N-[2-(5-bromofuran-2-yl)ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide |
| SMILES | CCC1CN(/C(=N/C)NCCc2ccc(Br)o2)CCS1 |
| InChI | InChI=1S/C14H22BrN3OS/c1-3-12-10-18(8-9-20-12)14(16-2)17-7-6-11-4-5-13(15)19-11/h4-5,12H,3,6-10H2,1-2H3,(H,16,17) |
| InChIKey | DEDJGABSSXQTCL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 40.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|