C24H35FN4O2 — CID 111623702
2-[(2-tert-butyloxan-3-yl)methyl]-1-ethyl-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]guanidine (PubChem CID 111623702) has the molecular formula C24H35FN4O2 and a molecular weight of 430.57 g/mol. Its IUPAC name is 2-[(2-tert-butyloxan-3-yl)methyl]-1-ethyl-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]guanidine.
| Compound Name | 2-[(2-tert-butyloxan-3-yl)methyl]-1-ethyl-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111623702 |
| Molecular Formula | C24H35FN4O2 |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 2-[(2-tert-butyloxan-3-yl)methyl]-1-ethyl-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]guanidine |
| SMILES | CCN/C(=N\CC1CCCOC1C(C)(C)C)NCCc1coc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C24H35FN4O2/c1-5-26-23(28-15-18-7-6-14-30-21(18)24(2,3)4)27-13-12-20-16-31-22(29-20)17-8-10-19(25)11-9-17/h8-11,16,18,21H,5-7,12-15H2,1-4H3,(H2,26,27,28) |
| InChIKey | YMJXXOXBSGGIBG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|