C17H28IN5OS — CID 111981750
1-ethyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide (PubChem CID 111981750) has the molecular formula C17H28IN5OS and a molecular weight of 477.42 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111981750 |
| Molecular Formula | C17H28IN5OS |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 1-ethyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]-2-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)c1ccsc1)NCCc1nc(C(C)C)no1.I |
| InChI | InChI=1S/C17H27N5OS.HI/c1-5-18-17(20-10-13(4)14-7-9-24-11-14)19-8-6-15-21-16(12(2)3)22-23-15;/h7,9,11-13H,5-6,8,10H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | ZKZWHTBDCGSGMQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|