C13H14FNO2S — CID 66115439
3-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]propan-1-ol (PubChem CID 66115439) has the molecular formula C13H14FNO2S and a molecular weight of 267.32 g/mol. Its IUPAC name is 3-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]propan-1-ol.
| Compound Name | 3-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 66115439 |
| Molecular Formula | C13H14FNO2S |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 3-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]propan-1-ol |
| SMILES | OCCCSCc1coc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C13H14FNO2S/c14-11-4-1-3-10(7-11)13-15-12(8-17-13)9-18-6-2-5-16/h1,3-4,7-8,16H,2,5-6,9H2 |
| InChIKey | MICHRLHDCMTZRG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|