About 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-amine
1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-amine (PubChem CID 65249857) has the molecular formula C13H14FN3O
and a molecular weight of 247.27 g/mol. Its IUPAC name is 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-amine.
Molecular Properties
| Compound Name | 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-amine |
| PubChem CID | 65249857 |
| Molecular Formula | C13H14FN3O |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-amine |
| SMILES | NC1CN(Cc2coc(-c3cccc(F)c3)n2)C1 |
| InChI | InChI=1S/C13H14FN3O/c14-10-3-1-2-9(4-10)13-16-12(8-18-13)7-17-5-11(15)6-17/h1-4,8,11H,5-7,15H2 |
| InChIKey | CEMHDWCOBDEOQY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-amine?
The IUPAC name of 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-amine (CID 65249857) is 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-amine.
What is the SMILES notation for 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-amine?
The canonical SMILES for 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-amine is NC1CN(Cc2coc(-c3cccc(F)c3)n2)C1.
What is the InChIKey of 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-amine?
The InChIKey is CEMHDWCOBDEOQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FN3O/c14-10-3-1-2-9(4-10)13-16-12(8-18-13)7-17-5-11(15)6-17/h1-4,8,11H,5-7,15H2.
What are the key properties of 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-amine?
1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-amine has a molecular weight of 247.27 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-amine is sourced from PubChem (CID 65249857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).