C9H6N2OS — CID 26695420
2-(2-thiophen-2-yl-1,3-oxazol-4-yl)acetonitrile (PubChem CID 26695420) has the molecular formula C9H6N2OS and a molecular weight of 190.23 g/mol. Its IUPAC name is 2-(2-thiophen-2-yl-1,3-oxazol-4-yl)acetonitrile.
| Compound Name | 2-(2-thiophen-2-yl-1,3-oxazol-4-yl)acetonitrile |
|---|---|
| PubChem CID | 26695420 |
| Molecular Formula | C9H6N2OS |
| Molecular Weight | 190.23 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | 2-(2-thiophen-2-yl-1,3-oxazol-4-yl)acetonitrile |
| SMILES | N#CCc1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C9H6N2OS/c10-4-3-7-6-12-9(11-7)8-2-1-5-13-8/h1-2,5-6H,3H2 |
| InChIKey | PKGUQPODFNOKNG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |