C17H11NOS — CID 102512631
3-naphthalen-2-yl-5-thiophen-2-yl-1,2-oxazole (PubChem CID 102512631) has the molecular formula C17H11NOS and a molecular weight of 277.35 g/mol. Its IUPAC name is 3-naphthalen-2-yl-5-thiophen-2-yl-1,2-oxazole.
| Compound Name | 3-naphthalen-2-yl-5-thiophen-2-yl-1,2-oxazole |
|---|---|
| PubChem CID | 102512631 |
| Molecular Formula | C17H11NOS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 3-naphthalen-2-yl-5-thiophen-2-yl-1,2-oxazole |
| SMILES | c1csc(-c2cc(-c3ccc4ccccc4c3)no2)c1 |
| InChI | InChI=1S/C17H11NOS/c1-2-5-13-10-14(8-7-12(13)4-1)15-11-16(19-18-15)17-6-3-9-20-17/h1-11H |
| InChIKey | BANJARWXMJKIHD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |