C16H10N2O2S3 — CID 122502656
5-[4-(5-methoxythiophen-2-yl)-2,1,3-benzothiadiazol-7-yl]thiophene-2-carbaldehyde (PubChem CID 122502656) has the molecular formula C16H10N2O2S3 and a molecular weight of 358.47 g/mol. Its IUPAC name is 5-[4-(5-methoxythiophen-2-yl)-2,1,3-benzothiadiazol-7-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[4-(5-methoxythiophen-2-yl)-2,1,3-benzothiadiazol-7-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 122502656 |
| Molecular Formula | C16H10N2O2S3 |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | 5-[4-(5-methoxythiophen-2-yl)-2,1,3-benzothiadiazol-7-yl]thiophene-2-carbaldehyde |
| SMILES | COc1ccc(-c2ccc(-c3ccc(C=O)s3)c3nsnc23)s1 |
| InChI | InChI=1S/C16H10N2O2S3/c1-20-14-7-6-13(22-14)11-4-3-10(15-16(11)18-23-17-15)12-5-2-9(8-19)21-12/h2-8H,1H3 |
| InChIKey | ZOAPWVCOPGRYKY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|