C26H29F2NO4 — CID 162357093
3-(3,5-difluorophenyl)-7-(10-ethenoxydecoxy)pyrano[2,3-b]pyridin-2-one (PubChem CID 162357093) has the molecular formula C26H29F2NO4 and a molecular weight of 457.52 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-7-(10-ethenoxydecoxy)pyrano[2,3-b]pyridin-2-one.
| Compound Name | 3-(3,5-difluorophenyl)-7-(10-ethenoxydecoxy)pyrano[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 162357093 |
| Molecular Formula | C26H29F2NO4 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 3-(3,5-difluorophenyl)-7-(10-ethenoxydecoxy)pyrano[2,3-b]pyridin-2-one |
| SMILES | C=COCCCCCCCCCCOc1ccc2cc(-c3cc(F)cc(F)c3)c(=O)oc2n1 |
| InChI | InChI=1S/C26H29F2NO4/c1-2-31-13-9-7-5-3-4-6-8-10-14-32-24-12-11-19-17-23(26(30)33-25(19)29-24)20-15-21(27)18-22(28)16-20/h2,11-12,15-18H,1,3-10,13-14H2 |
| InChIKey | JGXGVWOQNCPLSA-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|