C28H34FNO5 — CID 162356915
9-[3-(2-fluorophenyl)-2-oxopyrano[2,3-b]pyridin-7-yl]oxynonyl 2-methylbutanoate (PubChem CID 162356915) has the molecular formula C28H34FNO5 and a molecular weight of 483.58 g/mol. Its IUPAC name is 9-[3-(2-fluorophenyl)-2-oxopyrano[2,3-b]pyridin-7-yl]oxynonyl 2-methylbutanoate.
| Compound Name | 9-[3-(2-fluorophenyl)-2-oxopyrano[2,3-b]pyridin-7-yl]oxynonyl 2-methylbutanoate |
|---|---|
| PubChem CID | 162356915 |
| Molecular Formula | C28H34FNO5 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 9-[3-(2-fluorophenyl)-2-oxopyrano[2,3-b]pyridin-7-yl]oxynonyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCCCCCCCCOc1ccc2cc(-c3ccccc3F)c(=O)oc2n1 |
| InChI | InChI=1S/C28H34FNO5/c1-3-20(2)27(31)34-18-12-8-6-4-5-7-11-17-33-25-16-15-21-19-23(28(32)35-26(21)30-25)22-13-9-10-14-24(22)29/h9-10,13-16,19-20H,3-8,11-12,17-18H2,1-2H3 |
| InChIKey | FWGKEUICOPOIAU-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|