C29H34F3NO5 — CID 168824222
10-[2-oxo-3-[2-(trifluoromethyl)phenyl]pyrano[3,2-c]pyridin-7-yl]oxydecyl 2-methylpropanoate (PubChem CID 168824222) has the molecular formula C29H34F3NO5 and a molecular weight of 533.59 g/mol. Its IUPAC name is 10-[2-oxo-3-[2-(trifluoromethyl)phenyl]pyrano[3,2-c]pyridin-7-yl]oxydecyl 2-methylpropanoate.
| Compound Name | 10-[2-oxo-3-[2-(trifluoromethyl)phenyl]pyrano[3,2-c]pyridin-7-yl]oxydecyl 2-methylpropanoate |
|---|---|
| PubChem CID | 168824222 |
| Molecular Formula | C29H34F3NO5 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 10-[2-oxo-3-[2-(trifluoromethyl)phenyl]pyrano[3,2-c]pyridin-7-yl]oxydecyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCCCCCCCCCOc1cc2oc(=O)c(-c3ccccc3C(F)(F)F)cc2cn1 |
| InChI | InChI=1S/C29H34F3NO5/c1-20(2)27(34)37-16-12-8-6-4-3-5-7-11-15-36-26-18-25-21(19-33-26)17-23(28(35)38-25)22-13-9-10-14-24(22)29(30,31)32/h9-10,13-14,17-20H,3-8,11-12,15-16H2,1-2H3 |
| InChIKey | LRSGDUYXUVGYHI-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|