C34H49NO5S — CID 166860481
3-phenyl-7-[10-(2,3,5,5-tetramethylhexan-2-ylsulfonyl)decoxy]pyrano[3,2-c]pyridin-2-one (PubChem CID 166860481) has the molecular formula C34H49NO5S and a molecular weight of 583.84 g/mol. Its IUPAC name is 3-phenyl-7-[10-(2,3,5,5-tetramethylhexan-2-ylsulfonyl)decoxy]pyrano[3,2-c]pyridin-2-one.
| Compound Name | 3-phenyl-7-[10-(2,3,5,5-tetramethylhexan-2-ylsulfonyl)decoxy]pyrano[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 166860481 |
| Molecular Formula | C34H49NO5S |
| Molecular Weight | 583.84 g/mol |
| Exact Mass | 583.33 |
| IUPAC Name | 3-phenyl-7-[10-(2,3,5,5-tetramethylhexan-2-ylsulfonyl)decoxy]pyrano[3,2-c]pyridin-2-one |
| SMILES | CC(CC(C)(C)C)C(C)(C)S(=O)(=O)CCCCCCCCCCOc1cc2oc(=O)c(-c3ccccc3)cc2cn1 |
| InChI | InChI=1S/C34H49NO5S/c1-26(24-33(2,3)4)34(5,6)41(37,38)21-17-12-10-8-7-9-11-16-20-39-31-23-30-28(25-35-31)22-29(32(36)40-30)27-18-14-13-15-19-27/h13-15,18-19,22-23,25-26H,7-12,16-17,20-21,24H2,1-6H3 |
| InChIKey | SJRZNJUCEFSRRC-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.84 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|