C29H32F3NO4S — CID 162356863
S-[10-[4-[2-oxo-6-(2,2,2-trifluoroethyl)pyrano[2,3-b]pyridin-3-yl]phenoxy]decyl] prop-2-enethioate (PubChem CID 162356863) has the molecular formula C29H32F3NO4S and a molecular weight of 547.64 g/mol. Its IUPAC name is S-[10-[4-[2-oxo-6-(2,2,2-trifluoroethyl)pyrano[2,3-b]pyridin-3-yl]phenoxy]decyl] prop-2-enethioate.
| Compound Name | S-[10-[4-[2-oxo-6-(2,2,2-trifluoroethyl)pyrano[2,3-b]pyridin-3-yl]phenoxy]decyl] prop-2-enethioate |
|---|---|
| PubChem CID | 162356863 |
| Molecular Formula | C29H32F3NO4S |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | S-[10-[4-[2-oxo-6-(2,2,2-trifluoroethyl)pyrano[2,3-b]pyridin-3-yl]phenoxy]decyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCCCCCCCCCCOc1ccc(-c2cc3cc(CC(F)(F)F)cnc3oc2=O)cc1 |
| InChI | InChI=1S/C29H32F3NO4S/c1-2-26(34)38-16-10-8-6-4-3-5-7-9-15-36-24-13-11-22(12-14-24)25-18-23-17-21(19-29(30,31)32)20-33-27(23)37-28(25)35/h2,11-14,17-18,20H,1,3-10,15-16,19H2 |
| InChIKey | QICFODPKRQROOR-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|