C29H36F5NO5S — CID 162356741
10-[2-oxo-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrano[3,2-c]pyridin-7-yl]oxydecyl 2-methylbutanoate (PubChem CID 162356741) has the molecular formula C29H36F5NO5S and a molecular weight of 605.67 g/mol. Its IUPAC name is 10-[2-oxo-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrano[3,2-c]pyridin-7-yl]oxydecyl 2-methylbutanoate.
| Compound Name | 10-[2-oxo-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrano[3,2-c]pyridin-7-yl]oxydecyl 2-methylbutanoate |
|---|---|
| PubChem CID | 162356741 |
| Molecular Formula | C29H36F5NO5S |
| Molecular Weight | 605.67 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | 10-[2-oxo-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrano[3,2-c]pyridin-7-yl]oxydecyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCCCCCCCCCOc1cc2oc(=O)c(-c3ccc(S(F)(F)(F)(F)F)cc3)cc2cn1 |
| InChI | InChI=1S/C29H36F5NO5S/c1-3-21(2)28(36)39-17-11-9-7-5-4-6-8-10-16-38-27-19-26-23(20-35-27)18-25(29(37)40-26)22-12-14-24(15-13-22)41(30,31,32,33)34/h12-15,18-21H,3-11,16-17H2,1-2H3 |
| InChIKey | PZSJVGGHIHJSFV-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.67 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|