C27H30F5NO5S — CID 162356824
10-[2-oxo-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrano[3,2-c]pyridin-7-yl]oxydecyl prop-2-enoate (PubChem CID 162356824) has the molecular formula C27H30F5NO5S and a molecular weight of 575.60 g/mol. Its IUPAC name is 10-[2-oxo-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrano[3,2-c]pyridin-7-yl]oxydecyl prop-2-enoate.
| Compound Name | 10-[2-oxo-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrano[3,2-c]pyridin-7-yl]oxydecyl prop-2-enoate |
|---|---|
| PubChem CID | 162356824 |
| Molecular Formula | C27H30F5NO5S |
| Molecular Weight | 575.60 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | 10-[2-oxo-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrano[3,2-c]pyridin-7-yl]oxydecyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCCCCOc1cc2oc(=O)c(-c3ccc(S(F)(F)(F)(F)F)cc3)cc2cn1 |
| InChI | InChI=1S/C27H30F5NO5S/c1-2-26(34)37-16-10-8-6-4-3-5-7-9-15-36-25-18-24-21(19-33-25)17-23(27(35)38-24)20-11-13-22(14-12-20)39(28,29,30,31)32/h2,11-14,17-19H,1,3-10,15-16H2 |
| InChIKey | HBORMRUJMSLTGP-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.60 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|