C27H32F3NO5 — CID 162356784
6-(8-butan-2-yloxyoctoxy)-3-[4-(trifluoromethoxy)phenyl]pyrano[2,3-c]pyridin-2-one (PubChem CID 162356784) has the molecular formula C27H32F3NO5 and a molecular weight of 507.55 g/mol. Its IUPAC name is 6-(8-butan-2-yloxyoctoxy)-3-[4-(trifluoromethoxy)phenyl]pyrano[2,3-c]pyridin-2-one.
| Compound Name | 6-(8-butan-2-yloxyoctoxy)-3-[4-(trifluoromethoxy)phenyl]pyrano[2,3-c]pyridin-2-one |
|---|---|
| PubChem CID | 162356784 |
| Molecular Formula | C27H32F3NO5 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 6-(8-butan-2-yloxyoctoxy)-3-[4-(trifluoromethoxy)phenyl]pyrano[2,3-c]pyridin-2-one |
| SMILES | CCC(C)OCCCCCCCCOc1cc2cc(-c3ccc(OC(F)(F)F)cc3)c(=O)oc2cn1 |
| InChI | InChI=1S/C27H32F3NO5/c1-3-19(2)33-14-8-6-4-5-7-9-15-34-25-17-21-16-23(26(32)35-24(21)18-31-25)20-10-12-22(13-11-20)36-27(28,29)30/h10-13,16-19H,3-9,14-15H2,1-2H3 |
| InChIKey | NSLNJLSFXWDFNP-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|