C30H36F3NO5S — CID 162357057
9-[2-oxo-3-[3-(trifluoromethylsulfanyl)phenyl]pyrano[2,3-c]pyridin-6-yl]oxynonyl 2,2-dimethylbutanoate (PubChem CID 162357057) has the molecular formula C30H36F3NO5S and a molecular weight of 579.68 g/mol. Its IUPAC name is 9-[2-oxo-3-[3-(trifluoromethylsulfanyl)phenyl]pyrano[2,3-c]pyridin-6-yl]oxynonyl 2,2-dimethylbutanoate.
| Compound Name | 9-[2-oxo-3-[3-(trifluoromethylsulfanyl)phenyl]pyrano[2,3-c]pyridin-6-yl]oxynonyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 162357057 |
| Molecular Formula | C30H36F3NO5S |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | 9-[2-oxo-3-[3-(trifluoromethylsulfanyl)phenyl]pyrano[2,3-c]pyridin-6-yl]oxynonyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCCCCCCCCOc1cc2cc(-c3cccc(SC(F)(F)F)c3)c(=O)oc2cn1 |
| InChI | InChI=1S/C30H36F3NO5S/c1-4-29(2,3)28(36)38-16-11-9-7-5-6-8-10-15-37-26-19-22-18-24(27(35)39-25(22)20-34-26)21-13-12-14-23(17-21)40-30(31,32)33/h12-14,17-20H,4-11,15-16H2,1-3H3 |
| InChIKey | MGDVKCKQZVMWQM-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|