C26H31NO5 — CID 162356914
6-(2-oxo-3-phenylpyrano[2,3-c]pyridin-5-yl)oxyhexyl 2,2-dimethylbutanoate (PubChem CID 162356914) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is 6-(2-oxo-3-phenylpyrano[2,3-c]pyridin-5-yl)oxyhexyl 2,2-dimethylbutanoate.
| Compound Name | 6-(2-oxo-3-phenylpyrano[2,3-c]pyridin-5-yl)oxyhexyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 162356914 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 6-(2-oxo-3-phenylpyrano[2,3-c]pyridin-5-yl)oxyhexyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCCCCCOc1cncc2oc(=O)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C26H31NO5/c1-4-26(2,3)25(29)31-15-11-6-5-10-14-30-22-17-27-18-23-21(22)16-20(24(28)32-23)19-12-8-7-9-13-19/h7-9,12-13,16-18H,4-6,10-11,14-15H2,1-3H3 |
| InChIKey | IWLKMOBFLCZJGE-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|