C31H34O6 — CID 139472332
4-[5-[4-(2-methylprop-2-enoyloxy)butyl]-2-oxo-3-phenylchromen-7-yl]butyl 2-methylprop-2-enoate (PubChem CID 139472332) has the molecular formula C31H34O6 and a molecular weight of 502.61 g/mol. Its IUPAC name is 4-[5-[4-(2-methylprop-2-enoyloxy)butyl]-2-oxo-3-phenylchromen-7-yl]butyl 2-methylprop-2-enoate.
| Compound Name | 4-[5-[4-(2-methylprop-2-enoyloxy)butyl]-2-oxo-3-phenylchromen-7-yl]butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139472332 |
| Molecular Formula | C31H34O6 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 4-[5-[4-(2-methylprop-2-enoyloxy)butyl]-2-oxo-3-phenylchromen-7-yl]butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCc1cc(CCCCOC(=O)C(=C)C)c2cc(-c3ccccc3)c(=O)oc2c1 |
| InChI | InChI=1S/C31H34O6/c1-21(2)29(32)35-16-10-8-12-23-18-25(15-9-11-17-36-30(33)22(3)4)26-20-27(24-13-6-5-7-14-24)31(34)37-28(26)19-23/h5-7,13-14,18-20H,1,3,8-12,15-17H2,2,4H3 |
| InChIKey | LAVHJJFGLBAPBU-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|