C35H40O7 — CID 126548065
4-[5-[4-(2-methylprop-2-enoxy)butyl]-3-[4-(2-methylprop-2-enoyloxy)phenyl]-2-oxochromen-7-yl]butyl 2-methylprop-2-enoate (PubChem CID 126548065) has the molecular formula C35H40O7 and a molecular weight of 572.70 g/mol. Its IUPAC name is 4-[5-[4-(2-methylprop-2-enoxy)butyl]-3-[4-(2-methylprop-2-enoyloxy)phenyl]-2-oxochromen-7-yl]butyl 2-methylprop-2-enoate.
| Compound Name | 4-[5-[4-(2-methylprop-2-enoxy)butyl]-3-[4-(2-methylprop-2-enoyloxy)phenyl]-2-oxochromen-7-yl]butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 126548065 |
| Molecular Formula | C35H40O7 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | 4-[5-[4-(2-methylprop-2-enoxy)butyl]-3-[4-(2-methylprop-2-enoyloxy)phenyl]-2-oxochromen-7-yl]butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)COCCCCc1cc(CCCCOC(=O)C(=C)C)cc2oc(=O)c(-c3ccc(OC(=O)C(=C)C)cc3)cc12 |
| InChI | InChI=1S/C35H40O7/c1-23(2)22-39-17-9-8-12-28-19-26(11-7-10-18-40-33(36)24(3)4)20-32-30(28)21-31(35(38)42-32)27-13-15-29(16-14-27)41-34(37)25(5)6/h13-16,19-21H,1,3,5,7-12,17-18,22H2,2,4,6H3 |
| InChIKey | OQNOMTUACIWCAI-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|