C35H40O8 — CID 130254221
4-[7-[4-(2-methylprop-2-enoyloxy)butyl]-3-[4-(2-methylprop-2-enoyloxy)phenyl]-2-oxochromen-8-yl]butyl 2-methylpropanoate (PubChem CID 130254221) has the molecular formula C35H40O8 and a molecular weight of 588.70 g/mol. Its IUPAC name is 4-[7-[4-(2-methylprop-2-enoyloxy)butyl]-3-[4-(2-methylprop-2-enoyloxy)phenyl]-2-oxochromen-8-yl]butyl 2-methylpropanoate.
| Compound Name | 4-[7-[4-(2-methylprop-2-enoyloxy)butyl]-3-[4-(2-methylprop-2-enoyloxy)phenyl]-2-oxochromen-8-yl]butyl 2-methylpropanoate |
|---|---|
| PubChem CID | 130254221 |
| Molecular Formula | C35H40O8 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | 4-[7-[4-(2-methylprop-2-enoyloxy)butyl]-3-[4-(2-methylprop-2-enoyloxy)phenyl]-2-oxochromen-8-yl]butyl 2-methylpropanoate |
| SMILES | C=C(C)C(=O)OCCCCc1ccc2cc(-c3ccc(OC(=O)C(=C)C)cc3)c(=O)oc2c1CCCCOC(=O)C(C)C |
| InChI | InChI=1S/C35H40O8/c1-22(2)32(36)40-19-9-7-11-25-13-14-27-21-30(26-15-17-28(18-16-26)42-34(38)24(5)6)35(39)43-31(27)29(25)12-8-10-20-41-33(37)23(3)4/h13-18,21,23H,1,5,7-12,19-20H2,2-4,6H3 |
| InChIKey | OTIMKSUAVGXQHR-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|