C33H36O8 — CID 118243825
3-[6-[3-(1-hydroxy-2-methylprop-2-enoxy)propyl]-3-[4-(2-methylprop-2-enoyloxy)phenyl]-2-oxochromen-8-yl]propyl 2-methylprop-2-enoate (PubChem CID 118243825) has the molecular formula C33H36O8 and a molecular weight of 560.64 g/mol. Its IUPAC name is 3-[6-[3-(1-hydroxy-2-methylprop-2-enoxy)propyl]-3-[4-(2-methylprop-2-enoyloxy)phenyl]-2-oxochromen-8-yl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[6-[3-(1-hydroxy-2-methylprop-2-enoxy)propyl]-3-[4-(2-methylprop-2-enoyloxy)phenyl]-2-oxochromen-8-yl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118243825 |
| Molecular Formula | C33H36O8 |
| Molecular Weight | 560.64 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | 3-[6-[3-(1-hydroxy-2-methylprop-2-enoxy)propyl]-3-[4-(2-methylprop-2-enoyloxy)phenyl]-2-oxochromen-8-yl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(CCCOC(O)C(=C)C)cc2cc(-c3ccc(OC(=O)C(=C)C)cc3)c(=O)oc12 |
| InChI | InChI=1S/C33H36O8/c1-20(2)30(34)38-15-7-9-23-17-25(10-8-16-39-31(35)21(3)4)29-26(18-23)19-28(33(37)41-29)24-11-13-27(14-12-24)40-32(36)22(5)6/h11-14,17-19,30,34H,1,3,5,7-10,15-16H2,2,4,6H3 |
| InChIKey | FCEPOOZWCKLKEE-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|