C36H42O8 — CID 129059921
[4-[5,7-bis[4-(2-methylprop-2-enoyloxy)butyl]-2-oxochromen-3-yl]phenyl] 2,2-dimethylpropanoate (PubChem CID 129059921) has the molecular formula C36H42O8 and a molecular weight of 602.72 g/mol. Its IUPAC name is [4-[5,7-bis[4-(2-methylprop-2-enoyloxy)butyl]-2-oxochromen-3-yl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[5,7-bis[4-(2-methylprop-2-enoyloxy)butyl]-2-oxochromen-3-yl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 129059921 |
| Molecular Formula | C36H42O8 |
| Molecular Weight | 602.72 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | [4-[5,7-bis[4-(2-methylprop-2-enoyloxy)butyl]-2-oxochromen-3-yl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCCCCc1cc(CCCCOC(=O)C(=C)C)c2cc(-c3ccc(OC(=O)C(C)(C)C)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C36H42O8/c1-23(2)32(37)41-18-10-8-12-25-20-27(13-9-11-19-42-33(38)24(3)4)29-22-30(34(39)44-31(29)21-25)26-14-16-28(17-15-26)43-35(40)36(5,6)7/h14-17,20-22H,1,3,8-13,18-19H2,2,4-7H3 |
| InChIKey | PFTALPHDUYNGAV-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.72 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|