C27H34O3Si2 — CID 123185629
3-triphenylsilyloxysilylpropyl 2,2-dimethylbutanoate (PubChem CID 123185629) has the molecular formula C27H34O3Si2 and a molecular weight of 462.74 g/mol. Its IUPAC name is 3-triphenylsilyloxysilylpropyl 2,2-dimethylbutanoate.
| Compound Name | 3-triphenylsilyloxysilylpropyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 123185629 |
| Molecular Formula | C27H34O3Si2 |
| Molecular Weight | 462.74 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 3-triphenylsilyloxysilylpropyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCC[SiH2]O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H34O3Si2/c1-4-27(2,3)26(28)29-21-14-22-31-30-32(23-15-8-5-9-16-23,24-17-10-6-11-18-24)25-19-12-7-13-20-25/h5-13,15-20H,4,14,21-22,31H2,1-3H3 |
| InChIKey | DPVLEIZJWXCCFN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.74 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|