C19H26O4Si3 — CID 175109238
3-[diphenyl(silyloxy)silyl]oxysilylpropyl 2-methylprop-2-enoate (PubChem CID 175109238) has the molecular formula C19H26O4Si3 and a molecular weight of 402.67 g/mol. Its IUPAC name is 3-[diphenyl(silyloxy)silyl]oxysilylpropyl 2-methylprop-2-enoate.
| Compound Name | 3-[diphenyl(silyloxy)silyl]oxysilylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175109238 |
| Molecular Formula | C19H26O4Si3 |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 3-[diphenyl(silyloxy)silyl]oxysilylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[SiH2]O[Si](O[SiH3])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H26O4Si3/c1-16(2)19(20)21-14-9-15-25-23-26(22-24,17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-8,10-13H,1,9,14-15,25H2,2,24H3 |
| InChIKey | PBAFMHNWERQBPI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|